* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-BROMO-3-(2,2,2-TRIFLUOROETHOXY)PYRAZIN-2-AMINE |
| CAS: | 947249-22-1 |
| English Synonyms: | 5-BROMO-3-(2,2,2-TRIFLUOROETHOXY)PYRAZIN-2-AMINE |
| MDL Number.: | MFCD16996065 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1c(nc(c(n1)N)OCC(F)(F)F)Br |
| InChi: | InChI=1S/C6H5BrF3N3O/c7-3-1-12-4(11)5(13-3)14-2-6(8,9)10/h1H,2H2,(H2,11,12) |
| InChiKey: | InChIKey=FXSKBBHFAMOJHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.