* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHENOXATHIIN, 10-OXIDE |
| CAS: | 948-44-7 |
| English Synonyms: | PHENOXATHIIN, 10-OXIDE |
| MDL Number.: | MFCD00093073 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)Oc3ccccc3S2=O |
| InChi: | InChI=1S/C12H8O2S/c13-15-11-7-3-1-5-9(11)14-10-6-2-4-8-12(10)15/h1-8H |
| InChiKey: | InChIKey=ZESLIAUQVGLCIA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.