* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3-DIHYDRO-8-METHYL-2-THIOXOPYRAZOLO[1,5-A][1,3,5]TRIAZIN-4(1H)-ONE |
CAS: | 948575-59-5 |
English Synonyms: | 8-METHYL-2-THIOXO-2,3-DIHYDROPYRAZOLO[1,5-A][1,3,5]TRIAZIN-4(1H)-ONE ; 2,3-DIHYDRO-8-METHYL-2-THIOXOPYRAZOLO[1,5-A][1,3,5]TRIAZIN-4(1H)-ONE |
MDL Number.: | MFCD12755912 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1cnn2c1[nH]c(=S)[nH]c2=O |
InChi: | InChI=1S/C6H6N4OS/c1-3-2-7-10-4(3)8-5(12)9-6(10)11/h2H,1H3,(H2,8,9,11,12) |
InChiKey: | InChIKey=KQQGDHAPTJYQTO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.