* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (4R)-4-AMINO-4-PHENYLBUTAN-1-OL |
CAS: | 949096-34-8 |
English Synonyms: | ALPHACHIRON 1222209A788 ; (R)-4-AMINO-4-PHENYL-1-BUTANOL ; (4R)-4-AMINO-4-PHENYLBUTAN-1-OL |
MDL Number.: | MFCD10698828 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)[C@@H](CCCO)N |
InChi: | InChI=1S/C10H15NO/c11-10(7-4-8-12)9-5-2-1-3-6-9/h1-3,5-6,10,12H,4,7-8,11H2/t10-/m1/s1 |
InChiKey: | InChIKey=AGOPKBQSZNSGSA-SNVBAGLBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.