* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,4-DIAMINOPHENOL |
| CAS: | 95-86-3 ;34133-58-9 |
| English Synonyms: | 3,4-DIAMINOPHENOL ; 2,4-DIAMINOPHENOL |
| MDL Number.: | MFCD00025290 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | c1cc(c(cc1N)N)O |
| InChi: | InChI=1S/C6H8N2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H,7-8H2 |
| InChiKey: | InChIKey=XIWMTQIUUWJNRP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.