* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-BROMO-1,1-DIPHENYLETHANOL |
| CAS: | 950-16-3 |
| English Synonyms: | 2-BROMO-1,1-DIPHENYLETHANOL |
| MDL Number.: | MFCD00155187 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)C(CBr)(c2ccccc2)O |
| InChi: | InChI=1S/C14H13BrO/c15-11-14(16,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,16H,11H2 |
| InChiKey: | InChIKey=RRENRWFLQWLPKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.