* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SUC-VAL-PRO-PHE-PNA |
| CAS: | 95192-11-3 |
| English Synonyms: | SUC-VAL-PRO-PHE-PNA |
| MDL Number.: | MFCD00155549 |
| H bond acceptor: | 13 |
| H bond donor: | 4 |
| Smile: | CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc2ccccc2)C(=O)Nc3ccc(cc3)[N+](=O)[O-])NC(=O)CCC(=O)O |
| InChi: | InChI=1S/C29H35N5O8/c1-18(2)26(32-24(35)14-15-25(36)37)29(40)33-16-6-9-23(33)28(39)31-22(17-19-7-4-3-5-8-19)27(38)30-20-10-12-21(13-11-20)34(41)42/h3-5,7-8,10-13,18,22-23,26H,6,9,14-17H2,1-2H3,(H,30,38)(H,31,39)(H,32,35)(H,36,37)/t22-,23-,26-/m0/s1 |
| InChiKey: | InChIKey=QNIRAWWVNQTNGK-FXSPECFOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.