* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1-(2-Bromoethyl)-1H-pyrrole-2,5-dione |
CAS: | 95212-17-2 |
English Synonyms: | 1-(2-BROMOETHYL)-1H-PYRROLE-2,5-DIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrCCN1C(C=CC1=O)=O |
InChi: | InChI=1S/C6H6BrNO2/c7-3-4-8-5(9)1-2-6(8)10/h1-2H,3-4H2 |
InChiKey: | InChIKey=IGLSCNMIWMXHQB-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.