* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4(3H)-PYRIDINONE, 5-METHYL- |
CAS: | 953018-18-3 |
English Synonyms: | 5-METHYL-4(3H)-PYRIDINONE ; 4(3H)-PYRIDINONE, 5-METHYL- |
MDL Number.: | MFCD13175146 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC1=CN=CCC1=O |
InChi: | InChI=1S/C6H7NO/c1-5-4-7-3-2-6(5)8/h3-4H,2H2,1H3 |
InChiKey: | InChIKey=QOBXWBKANOMOCO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.