* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-INDAZOL-3-AMINE |
| CAS: | 953411-16-0 |
| English Synonyms: | 5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-INDAZOL-3-AMINE ; 5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-INDAZOL-3-AMINE |
| MDL Number.: | MFCD16995867 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc3c(c2)c(n[nH]3)N |
| InChi: | InChI=1S/C13H18BN3O2/c1-12(2)13(3,4)19-14(18-12)8-5-6-10-9(7-8)11(15)17-16-10/h5-7H,1-4H3,(H3,15,16,17) |
| InChiKey: | InChIKey=IVUMUNXPWHOTHY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.