* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-BETANA |
| CAS: | 95424-85-4 |
| English Synonyms: | Z-GLY-BETANA |
| MDL Number.: | MFCD00191096 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)COC(=O)NCC(=O)Nc2ccc3ccccc3c2 |
| InChi: | InChI=1S/C20H18N2O3/c23-19(13-21-20(24)25-14-15-6-2-1-3-7-15)22-18-11-10-16-8-4-5-9-17(16)12-18/h1-12H,13-14H2,(H,21,24)(H,22,23) |
| InChiKey: | InChIKey=QEQQHQJUDTUICR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.