* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(Cbz-amino)-2-butanone |
CAS: | 95484-17-6 |
English Synonyms: | 4-(CBZ-AMINO)-2-BUTANONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OCC1=CC=CC=C1)NCCC(C)=O |
InChi: | InChI=1S/C12H15NO3/c1-10(14)7-8-13-12(15)16-9-11-5-3-2-4-6-11/h2-6H,7-9H2,1H3,(H,13,15) |
InChiKey: | InChIKey=QVWVVHRNMKYYBJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.