* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-[3-(4-CHLOROPHENYL)-1,2,4-OXADIAZOL-5-YL]PIPERAZINE |
CAS: | 954850-14-7 |
English Synonyms: | 1-[3-(4-CHLOROPHENYL)-1,2,4-OXADIAZOL-5-YL]PIPERAZINE |
MDL Number.: | MFCD12027393 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(ccc1c2nc(on2)N3CCNCC3)Cl |
InChi: | InChI=1S/C12H13ClN4O/c13-10-3-1-9(2-4-10)11-15-12(18-16-11)17-7-5-14-6-8-17/h1-4,14H,5-8H2 |
InChiKey: | InChIKey=JSUGHTIRFNMJLZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.