Molecular Structure:
CAS No.:
95596-35-3
Product Name.:
CCD No.:CCD00551848
Formula:C5 H10 D4 N2
MolWeight:106.204
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 1,5-PENTANE-1,1,5,5-D4-DIAMINE |
| CAS： | 95596-35-3 |
| English Synonyms： | CADAVERINE-1,1,5,5-D4 ; 1,5-PENTANE-1,1,5,5-D4-DIAMINE ; 1,5-DIAMINOPENTANE-1,1,5,5-D4 |
| MDL Number.： | MFCD06658661 |
| H bond acceptor： | 2 |
| H bond donor： | 2 |
| Smile： | [2H]C([2H])(CCCC([2H])([2H])N)N |
| InChiKey： | InChIKey=null |
|
|
| Information： | 98 ATOM % D |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
