* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,7-DIBROMO-2-AZA-BICYCLO[2.2.1]HEPTAN-3-ONE |
CAS: | 95936-41-7 |
English Synonyms: | 6,7-DIBROMO-2-AZA-BICYCLO[2.2.1]HEPTAN-3-ONE |
MDL Number.: | MFCD12828532 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1[C@@H]2C([C@H](C1Br)NC2=O)Br |
InChi: | InChI=1S/C6H7Br2NO/c7-3-1-2-4(8)5(3)9-6(2)10/h2-5H,1H2,(H,9,10)/t2-,3?,4?,5+/m1/s1 |
InChiKey: | InChIKey=QQZMEXVRYDTMET-DMBMESGCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.