* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,4-DIBROMO-1H-PYRROLE |
CAS: | 95972-59-1 |
English Synonyms: | 3,4-DIBROMO-1H-PYRROLE ; 3,4-DIBROMOPYRROLE |
MDL Number.: | MFCD03931354 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1c(c(c[nH]1)Br)Br |
InChi: | InChI=1S/C4H3Br2N/c5-3-1-7-2-4(3)6/h1-2,7H |
InChiKey: | InChIKey=REBMNRMQTSWMMI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.