* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,4-BIS(1-METHYLBUTYL)PHENOL |
| CAS: | 96-94-6 |
| English Synonyms: | 2,4-DI-SEC-PENTYLPHENOL ; 2,4-BIS(1-METHYLBUTYL)PHENOL |
| MDL Number.: | MFCD00053784 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCC(C)c1ccc(c(c1)C(C)CCC)O |
| InChi: | InChI=1S/C16H26O/c1-5-7-12(3)14-9-10-16(17)15(11-14)13(4)8-6-2/h9-13,17H,5-8H2,1-4H3 |
| InChiKey: | InChIKey=QEVQVYGCTVKSER-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.