* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TRANS-2-METHYL-4-HEXEN-3-OL |
| CAS: | 96346-76-8 |
| English Synonyms: | (4E)-2-METHYLHEX-4-EN-3-OL ; TRANS-2-METHYL-4-HEXEN-3-OL |
| MDL Number.: | MFCD00048599 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C/C=C/C(C(C)C)O |
| InChi: | InChI=1S/C7H14O/c1-4-5-7(8)6(2)3/h4-8H,1-3H3/b5-4+ |
| InChiKey: | InChIKey=WFRYPJOHULJNDS-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.