* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | AC-ALA-ALA-PRO-ALA-PNA |
| CAS: | 96699-74-0 |
| English Synonyms: | AC-ALA-ALA-PRO-ALA-PNA |
| MDL Number.: | MFCD00077081 |
| H bond acceptor: | 13 |
| H bond donor: | 4 |
| Smile: | C[C@@H](C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)Nc2ccc(cc2)[N+](=O)[O-])NC(=O)C |
| InChi: | InChI=1S/C22H30N6O7/c1-12(23-15(4)29)19(30)25-14(3)22(33)27-11-5-6-18(27)21(32)24-13(2)20(31)26-16-7-9-17(10-8-16)28(34)35/h7-10,12-14,18H,5-6,11H2,1-4H3,(H,23,29)(H,24,32)(H,25,30)(H,26,31)/t12-,13-,14-,18-/m0/s1 |
| InChiKey: | InChIKey=LZJMHONERNXSNV-NUXNZHGMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.