* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(2-NAPHTHYL)-5-PHENYL-1,3,4-OXADIAZOLE |
| CAS: | 967-72-6 |
| English Synonyms: | 2-(2-NAPHTHYL)-5-PHENYL-1,3,4-OXADIAZOLE |
| MDL Number.: | MFCD00046451 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)c2nnc(o2)c3ccc4ccccc4c3 |
| InChi: | InChI=1S/C18H12N2O/c1-2-7-14(8-3-1)17-19-20-18(21-17)16-11-10-13-6-4-5-9-15(13)12-16/h1-12H |
| InChiKey: | InChIKey=PFFNHKOLVBEBJN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.