Molecular Structure:
CAS No.:
96737-93-8
Product Name.:
CCD No.:CCD00070867
Formula:C21 H30 D4 O2
MolWeight:322.522
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 5BETA-PREGNAN-3ALPHA-OL-20-ONE (17,21,21,21-D4) |
| CAS： | 96737-93-8 |
| English Synonyms： | 5BETA-PREGNAN-3ALPHA-OL-20-ONE-17ALPHA,21,21,21-D4 ; 5BETA-PREGNANE-3ALPHA-OL-20-ONE-17,21,21,21-D4 ; 5BETA-PREGNAN-3ALPHA-OL-20-ONE (17,21,21,21-D4) |
| MDL Number.： | MFCD00143090 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | [2H][C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C)C(=O)C([2H])([2H])[2H] |
| InChiKey： | InChIKey=null |
|
|
| Information： | 98 ATOM % D |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
