* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-2,4-DIHYDRO-1-OXO-1,2,4-TRIAZOLO[3,4-C][1,4]BENZOXAZINE |
| CAS: | 96753-80-9 |
| English Synonyms: | 8-METHYL-2,4-DIHYDRO-1-OXO-1,2,4-TRIAZOLO[3,4-C][1,4]BENZOXAZINE |
| MDL Number.: | MFCD01834023 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1ccc2c(c1)-n3c(n[nH]c3=O)CO2 |
| InChi: | InChI=1S/C10H9N3O2/c1-6-2-3-8-7(4-6)13-9(5-15-8)11-12-10(13)14/h2-4H,5H2,1H3,(H,12,14) |
| InChiKey: | InChIKey=XXZQYZCLPIMCBD-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.