* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (+)-(1S,2R)-MILNACIPRAN |
CAS: | 96847-54-0 |
English Synonyms: | L-MILNACIPRAN ; (+)-(1S,2R)-MILNACIPRAN |
MDL Number.: | MFCD12031415 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCN(CC)C(=O)[C@]1(C[C@H]1CN)c2ccccc2 |
InChi: | InChI=1S/C15H22N2O/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11,16H2,1-2H3/t13-,15+/m0/s1 |
InChiKey: | InChIKey=GJJFMKBJSRMPLA-DZGCQCFKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.