* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XCC |
| CAS: | 96865-83-7 |
| English Synonyms: | 2-[4-(2,6-DIOXO-1,3-DIPROPYL-7H-PURIN-8-YL)PHENOXY]ACETIC ACID ; XCC |
| MDL Number.: | MFCD19690956 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CCCn1c2c(c(=O)n(c1=O)CCC)[nH]c(n2)c3ccc(cc3)OCC(=O)O |
| InChi: | InChI=1S/C19H22N4O5/c1-3-9-22-17-15(18(26)23(10-4-2)19(22)27)20-16(21-17)12-5-7-13(8-6-12)28-11-14(24)25/h5-8H,3-4,9-11H2,1-2H3,(H,20,21)(H,24,25) |
| InChiKey: | InChIKey=QTMMGCYGCFXBFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.