* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (E)-3-CHLORO-2-METHYL-3-(2-THENYL) ACROLEIN |
| CAS: | 96924-57-1 |
| English Synonyms: | (E)-3-CHLORO-2-METHYL-3-(2-THENYL) ACROLEIN |
| MDL Number.: | MFCD12547050 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | C/C(=C(/c1cccs1)\Cl)/C=O |
| InChi: | InChI=1S/C8H7ClOS/c1-6(5-10)8(9)7-3-2-4-11-7/h2-5H,1H3/b8-6+ |
| InChiKey: | InChIKey=DEJITVOMCFNCDM-SOFGYWHQSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.