* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ARISTOLACTAM AIIIA |
| CAS: | 97399-91-2 |
| English Synonyms: | ARISTOLACTAM AIIIA |
| MDL Number.: | MFCD17214810 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | COc1c(cc2c3c1c4cc(ccc4cc3NC2=O)O)O |
| InChi: | InChI=1S/C16H11NO4/c1-21-15-12(19)6-10-13-11(17-16(10)20)4-7-2-3-8(18)5-9(7)14(13)15/h2-6,18-19H,1H3,(H,17,20) |
| InChiKey: | InChIKey=PFXGXKFPTAJYHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.