* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PANICULIDINE B |
CAS: | 97399-94-5 |
English Synonyms: | PANICULIDINE B |
MDL Number.: | MFCD17214813 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C[C@H](CCc1cn(c2c1cccc2)OC)CO |
InChi: | InChI=1S/C14H19NO2/c1-11(10-16)7-8-12-9-15(17-2)14-6-4-3-5-13(12)14/h3-6,9,11,16H,7-8,10H2,1-2H3/t11-/m1/s1 |
InChiKey: | InChIKey=FGYVMFMFZWJGDY-LLVKDONJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.