* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PANICULIDINE C |
| CAS: | 97399-95-6 |
| English Synonyms: | PANICULIDINE C |
| MDL Number.: | MFCD17214815 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | C[C@H](CCc1c[nH]c2c1cccc2)CO |
| InChi: | InChI=1S/C13H17NO/c1-10(9-15)6-7-11-8-14-13-5-3-2-4-12(11)13/h2-5,8,10,14-15H,6-7,9H2,1H3/t10-/m1/s1 |
| InChiKey: | InChIKey=OJDRKMFRRDQIRV-SNVBAGLBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.