* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CYCLOART-22-ENE-3,25-DIOL |
| CAS: | 97456-49-0 |
| English Synonyms: | CYCLOART-22-ENE-3,25-DIOL |
| MDL Number.: | MFCD17214913 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | C[C@H](/C=C/CC(C)(C)O)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)O)C)C |
| InChi: | InChI=1S/C30H50O2/c1-20(9-8-14-25(2,3)32)21-12-15-28(7)23-11-10-22-26(4,5)24(31)13-16-29(22)19-30(23,29)18-17-27(21,28)6/h8-9,20-24,31-32H,10-19H2,1-7H3/b9-8+/t20-,21-,22+,23+,24+,27-,28+,29-,30+/m1/s1 |
| InChiKey: | InChIKey=MAAZYVBWMZJVAO-VUTQOURGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.