* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULUKAST |
| CAS: | 98116-53-1 |
| English Synonyms: | SULUKAST |
| MDL Number.: | MFCD00864777 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CCCCCCCCC/C=C\C=C\[C@H]([C@H](c1cccc(c1)c2[nH]nnn2)O)SCCC(=O)O |
| InChi: | InChI=1S/C25H36N4O3S/c1-2-3-4-5-6-7-8-9-10-11-12-16-22(33-18-17-23(30)31)24(32)20-14-13-15-21(19-20)25-26-28-29-27-25/h10-16,19,22,24,32H,2-9,17-18H2,1H3,(H,30,31)(H,26,27,28,29)/b11-10-,16-12+/t22-,24+/m1/s1 |
| InChiKey: | InChIKey=YPHOSUPSOWQQCB-AFOLHBCXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.