Molecular Structure:
CAS No.:
98195-39-2
Product Name.:
CCD No.:CCD00096339
Formula:C10 Br D21
MolWeight:242.308
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 1-BROMODECANE-D21 |
| CAS： | 98195-39-2 |
| English Synonyms： | DECYL BROMIDE (D21) ; N-DECYL BROMIDE-D21 ; 1-BROMODECANE-D21 |
| MDL Number.： | MFCD00209694 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br |
| InChiKey： | InChIKey=null |
|
|
| Boiling Point： | 238 DEG C(LIT) |
| Density： | DENSITY: 1.166 G/ML AT 25 DEG C |
| Comments： | MASS SHIFT: M+21 UNSPSC: 12142200 WGK: 3 |
| Information： | ISOTOPIC PURITY: 98 ATOM % D MW: 241.88 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
