* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,5-DIMETHOXY-2-NAPHTHOIC ACID |
CAS: | 98410-68-5 |
English Synonyms: | 3,5-DIMETHOXY-2-NAPHTHOIC ACID |
MDL Number.: | MFCD05857770 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COc1cccc2c1cc(c(c2)C(=O)O)OC |
InChi: | InChI=1S/C13H12O4/c1-16-11-5-3-4-8-6-10(13(14)15)12(17-2)7-9(8)11/h3-7H,1-2H3,(H,14,15) |
InChiKey: | InChIKey=VTPNSKNCVKIPIX-UHFFFAOYSA-N |
Property |
|
Melting Point: | 167-171 DEG C(LIT) |
Comments: | UNSPSC: 12352100 WGK: 3 |
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.