* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CIS-1-((2-(2-BENZOFURANYL)-5-BUTYL-5-ETHYL-1,3-DIOXAN-2-YL)METHYL)-1H-1,2,4-TRIAZOLE |
| CAS: | 98532-84-4 |
| English Synonyms: | CIS-1-((2-(2-BENZOFURANYL)-5-BUTYL-5-ETHYL-1,3-DIOXAN-2-YL)METHYL)-1H-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD01761013 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCCC[C@@]1(CO[C@](OC1)(Cn2cncn2)c3cc4ccccc4o3)CC |
| InChi: | InChI=1S/C21H27N3O3/c1-3-5-10-20(4-2)13-25-21(26-14-20,12-24-16-22-15-23-24)19-11-17-8-6-7-9-18(17)27-19/h6-9,11,15-16H,3-5,10,12-14H2,1-2H3/t20-,21+ |
| InChiKey: | InChIKey=ZIBLQCIVFVPAHQ-OYRHEFFESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.