* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-((2-(2-BENZOFURANYL)-5-ETHYL-4-PROPYL-1,3-DIOXAN-2-YL)METHYL)-1H-1,2,4-TRIAZOLE |
| CAS: | 98532-85-5 |
| English Synonyms: | 1-((2-(2-BENZOFURANYL)-5-ETHYL-4-PROPYL-1,3-DIOXAN-2-YL)METHYL)-1H-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD01761036 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCCC1C(COC(O1)(Cn2cncn2)c3cc4ccccc4o3)CC |
| InChi: | InChI=1S/C20H25N3O3/c1-3-7-18-15(4-2)11-24-20(26-18,12-23-14-21-13-22-23)19-10-16-8-5-6-9-17(16)25-19/h5-6,8-10,13-15,18H,3-4,7,11-12H2,1-2H3 |
| InChiKey: | InChIKey=FDNGXABDLKHFPU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.