Molecular Structure:
CAS No.:
98556-65-1
Product Name.:
CCD No.:CCD00737693
Formula:C8 H4 N2 O4
MolWeight:192.13
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(5)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | 3-CYANO-5-NITROBENZOIC ACID |
| CAS： | 98556-65-1 |
| English Synonyms： | ABLOCK AB-12-6964 ; 3-CYANO-5-NITROBENZOIC ACID |
| MDL Number.： | MFCD09263223 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | c1c(cc(cc1C(=O)O)[N+](=O)[O-])C#N |
| InChi： | InChI=1S/C8H4N2O4/c9-4-5-1-6(8(11)12)3-7(2-5)10(13)14/h1-3H,(H,11,12) |
| InChiKey： | InChIKey=GHUIBKBNBPSUTC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
