Molecular Structure:
CAS No.:
98581-86-3
Product Name.:
CCD No.:CCD01277865
Formula:C8 H7 N3 O
MolWeight:161.163
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(34)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(10)
|
|
| Product Name： | 4-(4H-1,2,4-TRIAZOL-4-YL)PHENOL |
| CAS： | 98581-86-3 |
| English Synonyms： | 4-(4-HYDROXYPHENYL)-1,2,4-TRIAZOLE ; 4-(4H-1,2,4-TRIAZOL-4-YL)PHENOL ; 4-(1,2,4-TRIAZOL-4-YL)PHENOL ; ZERENEX E/9072536 |
| MDL Number.： | MFCD11855617 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1cc(ccc1n2cnnc2)O |
| InChi： | InChI=1S/C8H7N3O/c12-8-3-1-7(2-4-8)11-5-9-10-6-11/h1-6,12H |
| InChiKey： | InChIKey=RIBPDWQKLGLSLS-UHFFFAOYSA-N |
|
|
| Comments： | WARNINGS: IRRITANT |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
