* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3-Di-(Boc-amino)-2-hydroxypropane |
CAS: | 98642-15-0 |
English Synonyms: | 1,3-DI-(BOC-AMINO)-2-HYDROXYPROPANE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)NCC(CNC(=O)OC(C)(C)C)O |
InChi: | InChI=1S/C13H26N2O5/c1-12(2,3)19-10(17)14-7-9(16)8-15-11(18)20-13(4,5)6/h9,16H,7-8H2,1-6H3,(H,14,17)(H,15,18) |
InChiKey: | InChIKey=ZQIPILTVJGFFID-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.