* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,1'-(Hexa-2,4-diyne-1,6-diyl)bis(3-ethylurea) |
CAS: | 98786-22-2 |
English Synonyms: | 1,1'-(HEXA-2,4-DIYNE-1,6-DIYL)BIS(3-ETHYLUREA) |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C#CC#CCNC(=O)NCC)NC(=O)NCC |
InChi: | InChI=1S/C12H18N4O2/c1-3-13-11(17)15-9-7-5-6-8-10-16-12(18)14-4-2/h3-4,9-10H2,1-2H3,(H2,13,15,17)(H2,14,16,18) |
InChiKey: | InChIKey=PFCYYKFTWPGYCP-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.