* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | NAPHTHO[1,8-CD][1,2]DITHIOLE |
| CAS: | 209-22-3 ;98976-39-7 |
| English Synonyms: | 1,2-DITHIAACENAPHTHENE ; NAPHTHO[1,8-CD][1,2]DITHIOLE |
| MDL Number.: | MFCD00465089 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | c1cc2cccc3c2c(c1)SS3 |
| InChi: | InChI=1S/C10H6S2/c1-3-7-4-2-6-9-10(7)8(5-1)11-12-9/h1-6H |
| InChiKey: | InChIKey=NDOFGUDEKQECDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.