* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1H-ISOINDOLE-1,3(2H)-DIONE, 2-(6-AMINOHEXYL)- |
| CAS: | 98987-42-9 |
| English Synonyms: | 1H-ISOINDOLE-1,3(2H)-DIONE, 2-(6-AMINOHEXYL)- |
| MDL Number.: | MFCD09923470 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)C(=O)N(C2=O)CCCCCCN |
| InChi: | InChI=1S/C14H18N2O2/c15-9-5-1-2-6-10-16-13(17)11-7-3-4-8-12(11)14(16)18/h3-4,7-8H,1-2,5-6,9-10,15H2 |
| InChiKey: | InChIKey=UVCWESYZMOPBTO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.