* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-OCTYL-9H-FLUORENE |
| CAS: | 99012-34-7 |
| English Synonyms: | 2-OCTYL-9H-FLUORENE |
| MDL Number.: | MFCD00114636 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCCCCCCCc1ccc-2c(c1)Cc3c2cccc3 |
| InChi: | InChI=1S/C21H26/c1-2-3-4-5-6-7-10-17-13-14-21-19(15-17)16-18-11-8-9-12-20(18)21/h8-9,11-15H,2-7,10,16H2,1H3 |
| InChiKey: | InChIKey=RNQVXNPLQNQMTF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.