* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LIMONEXIC ACID |
CAS: | 99026-99-0 |
English Synonyms: | LIMONEXIC ACID |
MDL Number.: | MFCD17214831 |
H bond acceptor: | 10 |
H bond donor: | 1 |
Smile: | CC1([C@@H]2CC(=O)[C@@]3([C@@H]([C@]24COC(=O)C[C@@H]4O1)CC[C@@]5([C@]36[C@H](O6)C(=O)O[C@H]5C7=CC(=O)OC7O)C)C)C |
InChi: | InChI=1S/C26H30O10/c1-22(2)13-8-14(27)24(4)12(25(13)10-32-16(28)9-15(25)35-22)5-6-23(3)18(11-7-17(29)33-20(11)30)34-21(31)19-26(23,24)36-19/h7,12-13,15,18-20,30H,5-6,8-10H2,1-4H3/t12-,13-,15-,18-,19+,20?,23-,24-,25+,26+/m0/s1 |
InChiKey: | InChIKey=RTPPVNISJHFPFX-PEVOZZQFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.