* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISODESMOSINE |
CAS: | 991-01-5 |
English Synonyms: | ISODESMOSINE |
MDL Number.: | MFCD00211039 |
H bond acceptor: | 13 |
H bond donor: | 8 |
Smile: | c1c(c[n+](c(c1CCC(C(=O)O)N)CCCC(C(=O)O)N)CCCCC(C(=O)O)N)CCC(C(=O)O)N |
InChi: | InChI=1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1 |
InChiKey: | InChIKey=RGXCTRIQQODGIZ-UHFFFAOYSA-O |
* If the product has intellectual property rights, a license granted is must or contact us.