* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-CHLORO-8,9-DIMETHYL-9H-PURINE |
CAS: | 99158-55-1 |
English Synonyms: | 6-CHLORO-8,9-DIMETHYL-9H-PURINE |
MDL Number.: | MFCD16872301 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1nc2c(n1C)ncnc2Cl |
InChi: | InChI=1S/C7H7ClN4/c1-4-11-5-6(8)9-3-10-7(5)12(4)2/h3H,1-2H3 |
InChiKey: | InChIKey=GJAQIJSYKGXEBM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.