Molecular Structure:
CAS No.:
99343-21-2
Product Name.:
CCD No.:CCD01988855
Formula:C11 H20 F N O2
MolWeight:217.282
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | PYRROLIDINE, 1-(2-FLUORO-3-HYDROXY-4,4-DIMETHYL-1-OXOPENTYL)-, (R*,S*)- |
| CAS： | 99343-21-2 |
| English Synonyms： | PYRROLIDINE, 1-(2-FLUORO-3-HYDROXY-4,4-DIMETHYL-1-OXOPENTYL)-, (R*,S*)- |
| MDL Number.： | MFCD13173332 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CC(C)(C)[C@@H]([C@H](C(=O)N1CCCC1)F)O |
| InChi： | InChI=1S/C11H20FNO2/c1-11(2,3)9(14)8(12)10(15)13-6-4-5-7-13/h8-9,14H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChiKey： | InChIKey=KINPOPFMMKBXMY-RKDXNWHRSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
