* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (E)-5-(2-CARBOXYVINYL)URIDINE |
CAS: | 99394-52-2 |
English Synonyms: | (E)-5-(2-CARBOXYVINYL)URIDINE |
MDL Number.: | MFCD04973672 |
H bond acceptor: | 10 |
H bond donor: | 5 |
Smile: | c1c(c(=O)[nH]c(=O)n1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)/C=C/C(=O)O |
InChi: | InChI=1S/C12H14N2O8/c15-4-6-8(18)9(19)11(22-6)14-3-5(1-2-7(16)17)10(20)13-12(14)21/h1-3,6,8-9,11,15,18-19H,4H2,(H,16,17)(H,13,20,21)/b2-1+/t6-,8-,9-,11-/m1/s1 |
InChiKey: | InChIKey=FDZCPKBVFSOTDA-NPVTYPGSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.