* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-3-METHYLENE-8-AZA-BICYCLO[3.2.1]OCTANE |
| CAS: | 99838-33-2 |
| English Synonyms: | 8-METHYL-3-METHYLENE-8-AZA-BICYCLO[3.2.1]OCTANE |
| MDL Number.: | MFCD09834619 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CN1[C@H]2CC[C@@H]1CC(=C)C2 |
| InChi: | InChI=1S/C9H15N/c1-7-5-8-3-4-9(6-7)10(8)2/h8-9H,1,3-6H2,2H3/t8-,9+ |
| InChiKey: | InChIKey=VTTHRNBDRMKNKB-DTORHVGOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.