* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-CHLOROHEPTANE |
| CAS: | 999-52-0 |
| English Synonyms: | 3-CHLOROHEPTANE |
| MDL Number.: | MFCD00055273 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCCCC(CC)Cl |
| InChi: | InChI=1S/C7H15Cl/c1-3-5-6-7(8)4-2/h7H,3-6H2,1-2H3 |
| InChiKey: | InChIKey=DMKNOEJJJSHSML-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.