* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SERGOLEXOLE |
| CAS: | 108674-86-8 |
| English Synonyms: | SERGOLEXOLE |
| MDL Number.: | MFCD00876666 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC(C)n1cc2c3c1cccc3[C@H]4C[C@H](CN([C@@H]4C2)C)C(=O)OC5CCC(CC5)OC |
| InChi: | InChI=1S/C26H36N2O3/c1-16(2)28-15-17-13-24-22(21-6-5-7-23(28)25(17)21)12-18(14-27(24)3)26(29)31-20-10-8-19(30-4)9-11-20/h5-7,15-16,18-20,22,24H,8-14H2,1-4H3/t18-,19?,20?,22-,24-/m1/s1 |
| InChiKey: | InChIKey=RJBJIKXTJIZONR-FTNAIZGWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.