* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SURITOZOLE |
| CAS: | 110623-33-1 |
| English Synonyms: | SURITOZOLE ; 3-(3-FLUOROPHENYL)-1,4-DIMETHYL-1H-1,2,4-TRIAZOLE-5(4H)-THIONE |
| MDL Number.: | MFCD00865375 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cn1c(nn(c1=S)C)c2cccc(c2)F |
| InChi: | InChI=1S/C10H10FN3S/c1-13-9(12-14(2)10(13)15)7-4-3-5-8(11)6-7/h3-6H,1-2H3 |
| InChiKey: | InChIKey=IWDUZEHNLHFBRZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.